C16H12N2S2 — CID 12669864
2-(2-methyl-1,3-thiazol-4-yl)-10H-phenothiazine (PubChem CID 12669864) has the molecular formula C16H12N2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-10H-phenothiazine.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-10H-phenothiazine |
|---|---|
| PubChem CID | 12669864 |
| Molecular Formula | C16H12N2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-10H-phenothiazine |
| SMILES | Cc1nc(-c2ccc3c(c2)Nc2ccccc2S3)cs1 |
| InChI | InChI=1S/C16H12N2S2/c1-10-17-14(9-19-10)11-6-7-16-13(8-11)18-12-4-2-3-5-15(12)20-16/h2-9,18H,1H3 |
| InChIKey | BAWWZGCEQJWILE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|