C20H34N4O3S2 — CID 126705974
N-[5-[(Z)-[(E)-hexadec-9-enylidene]amino]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 126705974) has the molecular formula C20H34N4O3S2 and a molecular weight of 442.65 g/mol. Its IUPAC name is N-[5-[(Z)-[(E)-hexadec-9-enylidene]amino]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(Z)-[(E)-hexadec-9-enylidene]amino]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 126705974 |
| Molecular Formula | C20H34N4O3S2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[5-[(Z)-[(E)-hexadec-9-enylidene]amino]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CCCCCC/C=C/CCCCCCC/C=N\S(=O)(=O)c1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C20H34N4O3S2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-29(26,27)20-24-23-19(28-20)22-18(2)25/h8-9,17H,3-7,10-16H2,1-2H3,(H,22,23,25)/b9-8+,21-17- |
| InChIKey | DKKDYTYIKXNBIT-MFGUYFGASA-N |
| XLogP | 5.51 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|