C29H32N4O4S2 — CID 126715716
N-[(4aS,8aS)-8a-[4-[(2,4-dimethoxyphenyl)methylamino]-1,3-thiazol-2-yl]spiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclobutane]-2-yl]benzamide (PubChem CID 126715716) has the molecular formula C29H32N4O4S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is N-[(4aS,8aS)-8a-[4-[(2,4-dimethoxyphenyl)methylamino]-1,3-thiazol-2-yl]spiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclobutane]-2-yl]benzamide.
| Compound Name | N-[(4aS,8aS)-8a-[4-[(2,4-dimethoxyphenyl)methylamino]-1,3-thiazol-2-yl]spiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclobutane]-2-yl]benzamide |
|---|---|
| PubChem CID | 126715716 |
| Molecular Formula | C29H32N4O4S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N-[(4aS,8aS)-8a-[4-[(2,4-dimethoxyphenyl)methylamino]-1,3-thiazol-2-yl]spiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclobutane]-2-yl]benzamide |
| SMILES | COc1ccc(CNc2csc([C@@]34COC5(CCC5)C[C@@H]3CSC(NC(=O)c3ccccc3)=N4)n2)c(OC)c1 |
| InChI | InChI=1S/C29H32N4O4S2/c1-35-22-10-9-20(23(13-22)36-2)15-30-24-17-38-26(31-24)29-18-37-28(11-6-12-28)14-21(29)16-39-27(33-29)32-25(34)19-7-4-3-5-8-19/h3-5,7-10,13,17,21,30H,6,11-12,14-16,18H2,1-2H3,(H,32,33,34)/t21-,29-/m1/s1 |
| InChIKey | DJCOMKQALKLUDT-ONOMSOESSA-N |
| XLogP | 5.46 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |