C28H30N4O4S2 — CID 126715722
N-[8a-[4-[(2,4-dimethoxyphenyl)methylamino]-1,3-thiazol-2-yl]spiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclopropane]-2-yl]benzamide (PubChem CID 126715722) has the molecular formula C28H30N4O4S2 and a molecular weight of 550.71 g/mol. Its IUPAC name is N-[8a-[4-[(2,4-dimethoxyphenyl)methylamino]-1,3-thiazol-2-yl]spiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclopropane]-2-yl]benzamide.
| Compound Name | N-[8a-[4-[(2,4-dimethoxyphenyl)methylamino]-1,3-thiazol-2-yl]spiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclopropane]-2-yl]benzamide |
|---|---|
| PubChem CID | 126715722 |
| Molecular Formula | C28H30N4O4S2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | N-[8a-[4-[(2,4-dimethoxyphenyl)methylamino]-1,3-thiazol-2-yl]spiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclopropane]-2-yl]benzamide |
| SMILES | COc1ccc(CNc2csc(C34COC5(CC5)CC3CSC(NC(=O)c3ccccc3)=N4)n2)c(OC)c1 |
| InChI | InChI=1S/C28H30N4O4S2/c1-34-21-9-8-19(22(12-21)35-2)14-29-23-16-37-25(30-23)28-17-36-27(10-11-27)13-20(28)15-38-26(32-28)31-24(33)18-6-4-3-5-7-18/h3-9,12,16,20,29H,10-11,13-15,17H2,1-2H3,(H,31,32,33) |
| InChIKey | SRRKLSZKEUHXTI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |