C10H19NO2S — CID 126717836
N-(2-methylpropylsulfanyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-amine (PubChem CID 126717836) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-(2-methylpropylsulfanyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-amine.
| Compound Name | N-(2-methylpropylsulfanyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-amine |
|---|---|
| PubChem CID | 126717836 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(2-methylpropylsulfanyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-amine |
| SMILES | CC(C)CSNC1COC2CCOC12 |
| InChI | InChI=1S/C10H19NO2S/c1-7(2)6-14-11-8-5-13-9-3-4-12-10(8)9/h7-11H,3-6H2,1-2H3 |
| InChIKey | DQJCTYRBAPPNKM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|