C10H19NO3S — CID 145277198
N-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)-2-methylpropane-1-sulfinamide (PubChem CID 145277198) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is N-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)-2-methylpropane-1-sulfinamide.
| Compound Name | N-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)-2-methylpropane-1-sulfinamide |
|---|---|
| PubChem CID | 145277198 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)-2-methylpropane-1-sulfinamide |
| SMILES | CC(C)CS(=O)NC1COC2CCOC12 |
| InChI | InChI=1S/C10H19NO3S/c1-7(2)6-15(12)11-8-5-14-9-3-4-13-10(8)9/h7-11H,3-6H2,1-2H3 |
| InChIKey | CRTJKNDSVGLOKU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |