C26H36ClNO4 — CID 126728771
[(2E,3Z)-2,3-di(ethylidene)naphthalen-1-yl]methyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate (PubChem CID 126728771) has the molecular formula C26H36ClNO4 and a molecular weight of 462.03 g/mol. Its IUPAC name is [(2E,3Z)-2,3-di(ethylidene)naphthalen-1-yl]methyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate.
| Compound Name | [(2E,3Z)-2,3-di(ethylidene)naphthalen-1-yl]methyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 126728771 |
| Molecular Formula | C26H36ClNO4 |
| Molecular Weight | 462.03 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | [(2E,3Z)-2,3-di(ethylidene)naphthalen-1-yl]methyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
| SMILES | C/C=c1/cc2ccccc2c(COC(=O)NCCOCCOCCCCCCCl)/c1=C/C |
| InChI | InChI=1S/C26H36ClNO4/c1-3-21-19-22-11-7-8-12-24(22)25(23(21)4-2)20-32-26(29)28-14-16-31-18-17-30-15-10-6-5-9-13-27/h3-4,7-8,11-12,19H,5-6,9-10,13-18,20H2,1-2H3,(H,28,29)/b21-3-,23-4+ |
| InChIKey | GHAOJSQZKDKTNZ-VBGMDPIMSA-N |
| XLogP | 4.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.03 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|