C18H20F10O9S3 — CID 126756312
1,1-difluoro-2-[2-[2-[(2-fluoroacetyl)oxymethyl]-3-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-methylpropyl]sulfanyl-2-sulfanylcyclopentyl]oxy-2-oxoethanesulfonic acid (PubChem CID 126756312) has the molecular formula C18H20F10O9S3 and a molecular weight of 666.53 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-[2-[(2-fluoroacetyl)oxymethyl]-3-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-methylpropyl]sulfanyl-2-sulfanylcyclopentyl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-[2-[(2-fluoroacetyl)oxymethyl]-3-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-methylpropyl]sulfanyl-2-sulfanylcyclopentyl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 126756312 |
| Molecular Formula | C18H20F10O9S3 |
| Molecular Weight | 666.53 g/mol |
| Exact Mass | 666.01 |
| IUPAC Name | 1,1-difluoro-2-[2-[2-[(2-fluoroacetyl)oxymethyl]-3-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-methylpropyl]sulfanyl-2-sulfanylcyclopentyl]oxy-2-oxoethanesulfonic acid |
| SMILES | CC(COC(=O)CF)(COC(=O)C(F)(F)C(F)(F)C(F)(F)F)CSC1(S)CCCC1OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H20F10O9S3/c1-13(6-35-10(29)5-19,7-36-11(30)15(20,21)17(24,25)18(26,27)28)8-39-14(38)4-2-3-9(14)37-12(31)16(22,23)40(32,33)34/h9,38H,2-8H2,1H3,(H,32,33,34) |
| InChIKey | QZFXFZKMFKMGAG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|