C16H16NaO10 — CID 126960151
sodium 1,3,4,6-tetrakis(methoxycarbonyl)-5-oxo-1,5,6,6a-tetrahydro-2-pentalenolate (PubChem CID 126960151) has the molecular formula C16H16NaO10 and a molecular weight of 391.28 g/mol.
| Compound Name | sodium 1,3,4,6-tetrakis(methoxycarbonyl)-5-oxo-1,5,6,6a-tetrahydro-2-pentalenolate |
|---|---|
| PubChem CID | 126960151 |
| Molecular Formula | C16H16NaO10 |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | — |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)C2C1=C(C(=O)OC)C(=O)C2C(=O)OC.[Na] |
| InChI | InChI=1S/C16H16O10.Na/c1-23-13(19)7-5-6(9(11(7)17)15(21)25-3)10(16(22)26-4)12(18)8(5)14(20)24-2;/h5,7-8,17H,1-4H3; |
| InChIKey | KHJVQRMDSLXULE-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|