C16H16O10 — CID 92642845
tetramethyl (1R,6R,6aS)-2-hydroxy-5-oxo-6,6a-dihydro-1H-pentalene-1,3,4,6-tetracarboxylate (PubChem CID 92642845) has the molecular formula C16H16O10 and a molecular weight of 368.29 g/mol. Its IUPAC name is tetramethyl (1R,6R,6aS)-2-hydroxy-5-oxo-6,6a-dihydro-1H-pentalene-1,3,4,6-tetracarboxylate.
| Compound Name | tetramethyl (1R,6R,6aS)-2-hydroxy-5-oxo-6,6a-dihydro-1H-pentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 92642845 |
| Molecular Formula | C16H16O10 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | tetramethyl (1R,6R,6aS)-2-hydroxy-5-oxo-6,6a-dihydro-1H-pentalene-1,3,4,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)[C@H](C(=O)OC)[C@@H]2C1=C(C(=O)OC)C(=O)[C@@H]2C(=O)OC |
| InChI | InChI=1S/C16H16O10/c1-23-13(19)7-5-6(9(11(7)17)15(21)25-3)10(16(22)26-4)12(18)8(5)14(20)24-2/h5,7-8,17H,1-4H3/t5-,7+,8+/m0/s1 |
| InChIKey | HPUFUNLPVKTEJA-UIISKDMLSA-N |
| XLogP | -0.77 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|