C15H11N5OS — CID 127046438
2-(7-amino-5-thiophen-2-ylpyrazolo[4,3-d]pyrimidin-2-yl)phenol (PubChem CID 127046438) has the molecular formula C15H11N5OS and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-(7-amino-5-thiophen-2-ylpyrazolo[4,3-d]pyrimidin-2-yl)phenol.
| Compound Name | 2-(7-amino-5-thiophen-2-ylpyrazolo[4,3-d]pyrimidin-2-yl)phenol |
|---|---|
| PubChem CID | 127046438 |
| Molecular Formula | C15H11N5OS |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-(7-amino-5-thiophen-2-ylpyrazolo[4,3-d]pyrimidin-2-yl)phenol |
| SMILES | Nc1nc(-c2cccs2)nc2cn(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C15H11N5OS/c16-14-13-9(17-15(18-14)12-6-3-7-22-12)8-20(19-13)10-4-1-2-5-11(10)21/h1-8,21H,(H2,16,17,18) |
| InChIKey | CKHUVQWKDJVMTD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |