About 3-aminopropanimidamide;hydrobromide
3-aminopropanimidamide;hydrobromide (PubChem CID 12715904) has the molecular formula C3H10BrN3
and a molecular weight of 168.04 g/mol. Its IUPAC name is 3-aminopropanimidamide;hydrobromide.
Molecular Properties
| Compound Name | 3-aminopropanimidamide;hydrobromide |
| PubChem CID | 12715904 |
| Molecular Formula | C3H10BrN3 |
| Molecular Weight | 168.04 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | 3-aminopropanimidamide;hydrobromide |
| SMILES | Br.[H]/N=C(\N)CCN |
| InChI | InChI=1S/C3H9N3.BrH/c4-2-1-3(5)6;/h1-2,4H2,(H3,5,6);1H |
| InChIKey | ZETQEMOLHGSXHQ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.04 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropanimidamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropanimidamide;hydrobromide?
The IUPAC name of 3-aminopropanimidamide;hydrobromide (CID 12715904) is 3-aminopropanimidamide;hydrobromide.
What is the SMILES notation for 3-aminopropanimidamide;hydrobromide?
The canonical SMILES for 3-aminopropanimidamide;hydrobromide is Br.[H]/N=C(\N)CCN.
What is the InChIKey of 3-aminopropanimidamide;hydrobromide?
The InChIKey is ZETQEMOLHGSXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3.BrH/c4-2-1-3(5)6;/h1-2,4H2,(H3,5,6);1H.
What are the key properties of 3-aminopropanimidamide;hydrobromide?
3-aminopropanimidamide;hydrobromide has a molecular weight of 168.04 g/mol, XLogP of -0.15, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropanimidamide;hydrobromide is sourced from PubChem (CID 12715904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).