C16H17ClN4O3 — CID 127266342
methyl 3-[4-[(5-chloropyrazin-2-yl)methylcarbamoylamino]phenyl]propanoate (PubChem CID 127266342) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is methyl 3-[4-[(5-chloropyrazin-2-yl)methylcarbamoylamino]phenyl]propanoate.
| Compound Name | methyl 3-[4-[(5-chloropyrazin-2-yl)methylcarbamoylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 127266342 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | methyl 3-[4-[(5-chloropyrazin-2-yl)methylcarbamoylamino]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(NC(=O)NCc2cnc(Cl)cn2)cc1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-24-15(22)7-4-11-2-5-12(6-3-11)21-16(23)20-9-13-8-19-14(17)10-18-13/h2-3,5-6,8,10H,4,7,9H2,1H3,(H2,20,21,23) |
| InChIKey | QLZYMWBNLTXRNS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |