C13H17ClN2OS — CID 12833182
3-[4-[(E)-but-2-enyl]sulfanyl-3-chlorophenyl]-1,1-dimethylurea (PubChem CID 12833182) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is 3-[4-[(E)-but-2-enyl]sulfanyl-3-chlorophenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[(E)-but-2-enyl]sulfanyl-3-chlorophenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 12833182 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-[4-[(E)-but-2-enyl]sulfanyl-3-chlorophenyl]-1,1-dimethylurea |
| SMILES | C/C=C/CSc1ccc(NC(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C13H17ClN2OS/c1-4-5-8-18-12-7-6-10(9-11(12)14)15-13(17)16(2)3/h4-7,9H,8H2,1-3H3,(H,15,17)/b5-4+ |
| InChIKey | ZFTFTAHCDBBQPV-SNAWJCMRSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|