C11H9N3O — CID 12868772
5,10-dihydro-2H-diazepino[4,5-b]indol-1-one (PubChem CID 12868772) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 5,10-dihydro-2H-diazepino[4,5-b]indol-1-one.
| Compound Name | 5,10-dihydro-2H-diazepino[4,5-b]indol-1-one |
|---|---|
| PubChem CID | 12868772 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 5,10-dihydro-2H-diazepino[4,5-b]indol-1-one |
| SMILES | O=C1NN=CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C11H9N3O/c15-11-10-8(5-6-12-14-11)7-3-1-2-4-9(7)13-10/h1-4,6,13H,5H2,(H,14,15) |
| InChIKey | PFBQZQILWRJVGP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|