C12H19N4O2P — CID 129028827
[4-[[amino-(methylphosphanylamino)methylidene]amino]phenyl] 2-amino-2-methylpropanoate (PubChem CID 129028827) has the molecular formula C12H19N4O2P and a molecular weight of 282.28 g/mol. Its IUPAC name is [4-[[amino-(methylphosphanylamino)methylidene]amino]phenyl] 2-amino-2-methylpropanoate.
| Compound Name | [4-[[amino-(methylphosphanylamino)methylidene]amino]phenyl] 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 129028827 |
| Molecular Formula | C12H19N4O2P |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [4-[[amino-(methylphosphanylamino)methylidene]amino]phenyl] 2-amino-2-methylpropanoate |
| SMILES | CPN/C(N)=N/c1ccc(OC(=O)C(C)(C)N)cc1 |
| InChI | InChI=1S/C12H19N4O2P/c1-12(2,14)10(17)18-9-6-4-8(5-7-9)15-11(13)16-19-3/h4-7,19H,14H2,1-3H3,(H3,13,15,16) |
| InChIKey | GDCYKDHVHBPKKZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|