About 2-(methyldisulfanyl)-3,5-dinitropyridine
2-(methyldisulfanyl)-3,5-dinitropyridine (PubChem CID 129062070) has the molecular formula C6H5N3O4S2
and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-(methyldisulfanyl)-3,5-dinitropyridine.
Molecular Properties
| Compound Name | 2-(methyldisulfanyl)-3,5-dinitropyridine |
| PubChem CID | 129062070 |
| Molecular Formula | C6H5N3O4S2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | 2-(methyldisulfanyl)-3,5-dinitropyridine |
| SMILES | CSSc1ncc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5N3O4S2/c1-14-15-6-5(9(12)13)2-4(3-7-6)8(10)11/h2-3H,1H3 |
| InChIKey | ZKSHDZQJMZFGNM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(methyldisulfanyl)-3,5-dinitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methyldisulfanyl)-3,5-dinitropyridine?
The IUPAC name of 2-(methyldisulfanyl)-3,5-dinitropyridine (CID 129062070) is 2-(methyldisulfanyl)-3,5-dinitropyridine.
What is the SMILES notation for 2-(methyldisulfanyl)-3,5-dinitropyridine?
The canonical SMILES for 2-(methyldisulfanyl)-3,5-dinitropyridine is CSSc1ncc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-(methyldisulfanyl)-3,5-dinitropyridine?
The InChIKey is ZKSHDZQJMZFGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O4S2/c1-14-15-6-5(9(12)13)2-4(3-7-6)8(10)11/h2-3H,1H3.
What are the key properties of 2-(methyldisulfanyl)-3,5-dinitropyridine?
2-(methyldisulfanyl)-3,5-dinitropyridine has a molecular weight of 247.26 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methyldisulfanyl)-3,5-dinitropyridine is sourced from PubChem (CID 129062070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).