C11H12N4 — CID 129074750
5-[(2E)-penta-2,4-dien-2-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine (PubChem CID 129074750) has the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-[(2E)-penta-2,4-dien-2-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine.
| Compound Name | 5-[(2E)-penta-2,4-dien-2-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 129074750 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5-[(2E)-penta-2,4-dien-2-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine |
| SMILES | C=C/C=C(\C)c1cnc2n[nH]c(N)c2c1 |
| InChI | InChI=1S/C11H12N4/c1-3-4-7(2)8-5-9-10(12)14-15-11(9)13-6-8/h3-6H,1H2,2H3,(H3,12,13,14,15)/b7-4+ |
| InChIKey | UOYFUCOEVCIQIH-QPJJXVBHSA-N |
| XLogP | 2.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|