About 3-iodocinnoline
3-iodocinnoline (PubChem CID 12908769) has the molecular formula C8H5IN2
and a molecular weight of 256.05 g/mol. Its IUPAC name is 3-iodocinnoline.
Molecular Properties
| Compound Name | 3-iodocinnoline |
| PubChem CID | 12908769 |
| Molecular Formula | C8H5IN2 |
| Molecular Weight | 256.05 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 3-iodocinnoline |
| SMILES | Ic1cc2ccccc2nn1 |
| InChI | InChI=1S/C8H5IN2/c9-8-5-6-3-1-2-4-7(6)10-11-8/h1-5H |
| InChIKey | GOGSVLAIFJIPOL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.05 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodocinnoline?
The IUPAC name of 3-iodocinnoline (CID 12908769) is 3-iodocinnoline.
What is the SMILES notation for 3-iodocinnoline?
The canonical SMILES for 3-iodocinnoline is Ic1cc2ccccc2nn1.
What is the InChIKey of 3-iodocinnoline?
The InChIKey is GOGSVLAIFJIPOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5IN2/c9-8-5-6-3-1-2-4-7(6)10-11-8/h1-5H.
What are the key properties of 3-iodocinnoline?
3-iodocinnoline has a molecular weight of 256.05 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodocinnoline is sourced from PubChem (CID 12908769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).