C17H20O6 — CID 129120047
2-(3,4-dihydroxyphenyl)ethyl 2-[(4S)-3-ethenyl-2-oxooxan-4-yl]acetate (PubChem CID 129120047) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethyl 2-[(4S)-3-ethenyl-2-oxooxan-4-yl]acetate.
| Compound Name | 2-(3,4-dihydroxyphenyl)ethyl 2-[(4S)-3-ethenyl-2-oxooxan-4-yl]acetate |
|---|---|
| PubChem CID | 129120047 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethyl 2-[(4S)-3-ethenyl-2-oxooxan-4-yl]acetate |
| SMILES | C=CC1C(=O)OCC[C@H]1CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H20O6/c1-2-13-12(6-8-23-17(13)21)10-16(20)22-7-5-11-3-4-14(18)15(19)9-11/h2-4,9,12-13,18-19H,1,5-8,10H2/t12-,13?/m0/s1 |
| InChIKey | ZKNFWIMQHCLSCI-UEWDXFNNSA-N |
| XLogP | 1.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|