C31H40N4O2 — CID 129150432
2-[2-[(3-benzyl-7-methyl-2,8-diphenyl-1,3,7-triazabicyclo[3.3.1]nonan-5-yl)methoxy]ethoxy]ethanamine (PubChem CID 129150432) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 2-[2-[(3-benzyl-7-methyl-2,8-diphenyl-1,3,7-triazabicyclo[3.3.1]nonan-5-yl)methoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[(3-benzyl-7-methyl-2,8-diphenyl-1,3,7-triazabicyclo[3.3.1]nonan-5-yl)methoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 129150432 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 2-[2-[(3-benzyl-7-methyl-2,8-diphenyl-1,3,7-triazabicyclo[3.3.1]nonan-5-yl)methoxy]ethoxy]ethanamine |
| SMILES | CN1CC2(COCCOCCN)CN(Cc3ccccc3)C(c3ccccc3)N(C2)C1c1ccccc1 |
| InChI | InChI=1S/C31H40N4O2/c1-33-22-31(25-37-20-19-36-18-17-32)23-34(21-26-11-5-2-6-12-26)30(28-15-9-4-10-16-28)35(24-31)29(33)27-13-7-3-8-14-27/h2-16,29-30H,17-25,32H2,1H3 |
| InChIKey | JUPVOLNPLLZFIP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|