C30H33Cl2N3O2 — CID 129153482
(3S,5S,6S)-6-(4-chlorophenyl)-5-[(3-chlorophenyl)methyl]-1-[(1S)-1-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propyl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 129153482) has the molecular formula C30H33Cl2N3O2 and a molecular weight of 538.52 g/mol. Its IUPAC name is (3S,5S,6S)-6-(4-chlorophenyl)-5-[(3-chlorophenyl)methyl]-1-[(1S)-1-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propyl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,5S,6S)-6-(4-chlorophenyl)-5-[(3-chlorophenyl)methyl]-1-[(1S)-1-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 129153482 |
| Molecular Formula | C30H33Cl2N3O2 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | (3S,5S,6S)-6-(4-chlorophenyl)-5-[(3-chlorophenyl)methyl]-1-[(1S)-1-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)C[C@H](Cc2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@@H](CC)c2nc(C3CC3)no2)C1=O |
| InChI | InChI=1S/C30H33Cl2N3O2/c1-4-15-30(3)18-22(16-19-7-6-8-24(32)17-19)26(20-11-13-23(31)14-12-20)35(29(30)36)25(5-2)28-33-27(34-37-28)21-9-10-21/h4,6-8,11-14,17,21-22,25-26H,1,5,9-10,15-16,18H2,2-3H3/t22-,25-,26+,30-/m0/s1 |
| InChIKey | XTLCHBMGZLJKBL-UGMGLIFWSA-N |
| XLogP | 8.12 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|