C29H31Cl2N3O2 — CID 89481444
(3S,5R,6S)-5-(3-chlorophenyl)-6-[(3R)-3-(4-chlorophenyl)-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propyl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 89481444) has the molecular formula C29H31Cl2N3O2 and a molecular weight of 524.49 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-[(3R)-3-(4-chlorophenyl)-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propyl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-[(3R)-3-(4-chlorophenyl)-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 89481444 |
| Molecular Formula | C29H31Cl2N3O2 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-[(3R)-3-(4-chlorophenyl)-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)[C@H](CC[C@H](c2ccc(Cl)cc2)c2nc(C3CC3)no2)NC1=O |
| InChI | InChI=1S/C29H31Cl2N3O2/c1-3-15-29(2)17-24(20-5-4-6-22(31)16-20)25(32-28(29)35)14-13-23(18-9-11-21(30)12-10-18)27-33-26(34-36-27)19-7-8-19/h3-6,9-12,16,19,23-25H,1,7-8,13-15,17H2,2H3,(H,32,35)/t23-,24-,25+,29+/m1/s1 |
| InChIKey | WYXNJPUYJSLQSE-ANARSLNQSA-N |
| XLogP | 7.42 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|