C30H23ClN3+ — CID 12915374
4-chloro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide (PubChem CID 12915374) has the molecular formula C30H23ClN3+ and a molecular weight of 460.99 g/mol. Its IUPAC name is 4-chloro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide.
| Compound Name | 4-chloro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 12915374 |
| Molecular Formula | C30H23ClN3+ |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-chloro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide |
| SMILES | N/C(=N\[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H23ClN3/c31-27-18-16-25(17-19-27)30(32)33-34-28(23-12-6-2-7-13-23)20-26(22-10-4-1-5-11-22)21-29(34)24-14-8-3-9-15-24/h1-21H,(H2,32,33)/q+1 |
| InChIKey | SCMOCONSPZYQDE-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 42.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|