C36H27BClF4N3 — CID 12915384
N'-(4-chlorophenyl)-N-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide tetrafluoroborate (PubChem CID 12915384) has the molecular formula C36H27BClF4N3 and a molecular weight of 623.89 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide tetrafluoroborate.
| Compound Name | N'-(4-chlorophenyl)-N-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide tetrafluoroborate |
|---|---|
| PubChem CID | 12915384 |
| Molecular Formula | C36H27BClF4N3 |
| Molecular Weight | 623.89 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | N'-(4-chlorophenyl)-N-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide tetrafluoroborate |
| SMILES | Clc1ccc(/N=C(/N[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)c2ccccc2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C36H27ClN3.BF4/c37-32-21-23-33(24-22-32)38-36(30-19-11-4-12-20-30)39-40-34(28-15-7-2-8-16-28)25-31(27-13-5-1-6-14-27)26-35(40)29-17-9-3-10-18-29;2-1(3,4)5/h1-26H,(H,38,39);/q+1;-1 |
| InChIKey | MYKTWNIEORFHMA-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 28.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.89 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|