C21H16ClNO — CID 71346027
3-(4-chlorophenyl)imino-1,3-diphenylpropan-1-one (PubChem CID 71346027) has the molecular formula C21H16ClNO and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)imino-1,3-diphenylpropan-1-one.
| Compound Name | 3-(4-chlorophenyl)imino-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 71346027 |
| Molecular Formula | C21H16ClNO |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-(4-chlorophenyl)imino-1,3-diphenylpropan-1-one |
| SMILES | O=C(C/C(=N\c1ccc(Cl)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16ClNO/c22-18-11-13-19(14-12-18)23-20(16-7-3-1-4-8-16)15-21(24)17-9-5-2-6-10-17/h1-14H,15H2/b23-20+ |
| InChIKey | FJFNTNJIWLJNNZ-BSYVCWPDSA-N |
| XLogP | 5.73 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|