About (E)-4,5-diaminopent-4-enenitrile
(E)-4,5-diaminopent-4-enenitrile (PubChem CID 129158264) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is (E)-4,5-diaminopent-4-enenitrile.
Molecular Properties
| Compound Name | (E)-4,5-diaminopent-4-enenitrile |
| PubChem CID | 129158264 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | (E)-4,5-diaminopent-4-enenitrile |
| SMILES | N#CCC/C(N)=C\N |
| InChI | InChI=1S/C5H9N3/c6-3-1-2-5(8)4-7/h4H,1-2,7-8H2/b5-4+ |
| InChIKey | DYOIGKPLFYPQPC-SNAWJCMRSA-N |
| XLogP | 0.05 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-4,5-diaminopent-4-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,5-diaminopent-4-enenitrile?
The IUPAC name of (E)-4,5-diaminopent-4-enenitrile (CID 129158264) is (E)-4,5-diaminopent-4-enenitrile.
What is the SMILES notation for (E)-4,5-diaminopent-4-enenitrile?
The canonical SMILES for (E)-4,5-diaminopent-4-enenitrile is N#CCC/C(N)=C\N.
What is the InChIKey of (E)-4,5-diaminopent-4-enenitrile?
The InChIKey is DYOIGKPLFYPQPC-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H9N3/c6-3-1-2-5(8)4-7/h4H,1-2,7-8H2/b5-4+.
What are the key properties of (E)-4,5-diaminopent-4-enenitrile?
(E)-4,5-diaminopent-4-enenitrile has a molecular weight of 111.15 g/mol, XLogP of 0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,5-diaminopent-4-enenitrile is sourced from PubChem (CID 129158264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).