C32H35F2N5O4 — CID 129168179
4-butan-2-yl-2-[4-[4-[4-[[(2R,4R)-2-(2,4-difluorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 129168179) has the molecular formula C32H35F2N5O4 and a molecular weight of 591.66 g/mol. Its IUPAC name is 4-butan-2-yl-2-[4-[4-[4-[[(2R,4R)-2-(2,4-difluorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 4-butan-2-yl-2-[4-[4-[4-[[(2R,4R)-2-(2,4-difluorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 129168179 |
| Molecular Formula | C32H35F2N5O4 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | 4-butan-2-yl-2-[4-[4-[4-[[(2R,4R)-2-(2,4-difluorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1cnn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@H](c6ccc(F)cc6F)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C32H35F2N5O4/c1-3-22(2)38-21-35-39(32(38)40)26-7-5-24(6-8-26)36-14-16-37(17-15-36)25-9-11-27(12-10-25)41-19-28-20-42-31(43-28)29-13-4-23(33)18-30(29)34/h4-13,18,21-22,28,31H,3,14-17,19-20H2,1-2H3/t22?,28-,31-/m1/s1 |
| InChIKey | UENPYZFMWAKCPT-HGKSRYNISA-N |
| XLogP | 5.10 |
| TPSA | 73.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|