C19H13Cl3F6N2O — CID 129200850
3,3,3-trifluoro-N-[[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-pyridinyl]methyl]propanamide (PubChem CID 129200850) has the molecular formula C19H13Cl3F6N2O and a molecular weight of 505.67 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-pyridinyl]methyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-pyridinyl]methyl]propanamide |
|---|---|
| PubChem CID | 129200850 |
| Molecular Formula | C19H13Cl3F6N2O |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | 3,3,3-trifluoro-N-[[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-pyridinyl]methyl]propanamide |
| SMILES | O=C(CC(F)(F)F)NCc1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H13Cl3F6N2O/c20-14-5-11(6-15(21)17(14)22)13(19(26,27)28)4-2-10-1-3-12(29-8-10)9-30-16(31)7-18(23,24)25/h1-6,8,13H,7,9H2,(H,30,31)/b4-2+ |
| InChIKey | LOFDQVJMKKCBEG-DUXPYHPUSA-N |
| XLogP | 6.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|