C16H21N3O — CID 129213344
(6aR)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-amine (PubChem CID 129213344) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (6aR)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-amine.
| Compound Name | (6aR)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-amine |
|---|---|
| PubChem CID | 129213344 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (6aR)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-amine |
| SMILES | COC12CC(N)CN(C)[C@@H]1Cc1c[nH]c3cccc2c13 |
| InChI | InChI=1S/C16H21N3O/c1-19-9-11(17)7-16(20-2)12-4-3-5-13-15(12)10(8-18-13)6-14(16)19/h3-5,8,11,14,18H,6-7,9,17H2,1-2H3/t11?,14-,16?/m1/s1 |
| InChIKey | YEYUYFDIXFUVHC-OFWKBQFLSA-N |
| XLogP | 1.60 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |