C23H29N5O — CID 13251460
5-[[(6aR,9R,10aS)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl]-4,6-dimethylpyrimidin-2-amine (PubChem CID 13251460) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is 5-[[(6aR,9R,10aS)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | 5-[[(6aR,9R,10aS)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 13251460 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 5-[[(6aR,9R,10aS)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl]-4,6-dimethylpyrimidin-2-amine |
| SMILES | CO[C@]12C[C@@H](Cc3c(C)nc(N)nc3C)CN(C)[C@@H]1Cc1c[nH]c3cccc2c13 |
| InChI | InChI=1S/C23H29N5O/c1-13-17(14(2)27-22(24)26-13)8-15-10-23(29-4)18-6-5-7-19-21(18)16(11-25-19)9-20(23)28(3)12-15/h5-7,11,15,20,25H,8-10,12H2,1-4H3,(H2,24,26,27)/t15-,20-,23+/m1/s1 |
| InChIKey | IFSIUPFWEOPCQH-OFSQETHSSA-N |
| XLogP | 3.12 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |