C16H18N2 — CID 138969772
(7R)-4,6-dimethyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene (PubChem CID 138969772) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (7R)-4,6-dimethyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene.
| Compound Name | (7R)-4,6-dimethyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene |
|---|---|
| PubChem CID | 138969772 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (7R)-4,6-dimethyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene |
| SMILES | CN1CC2(C)CC23c2cccc4[nH]cc(c24)C[C@@H]13 |
| InChI | InChI=1S/C16H18N2/c1-15-8-16(15)11-4-3-5-12-14(11)10(7-17-12)6-13(16)18(2)9-15/h3-5,7,13,17H,6,8-9H2,1-2H3/t13-,15?,16?/m1/s1 |
| InChIKey | ZWJHDICNUKHUGE-IUDNXUCKSA-N |
| XLogP | 2.69 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |