C21H27N3O2 — CID 154370760
4-[[(6aR,10aS)-10a-methoxy-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methyl]morpholine (PubChem CID 154370760) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-[[(6aR,10aS)-10a-methoxy-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methyl]morpholine.
| Compound Name | 4-[[(6aR,10aS)-10a-methoxy-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methyl]morpholine |
|---|---|
| PubChem CID | 154370760 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 4-[[(6aR,10aS)-10a-methoxy-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methyl]morpholine |
| SMILES | CO[C@]12C=C(CN3CCOCC3)CN(C)[C@@H]1Cc1c[nH]c3cccc2c13 |
| InChI | InChI=1S/C21H27N3O2/c1-23-13-15(14-24-6-8-26-9-7-24)11-21(25-2)17-4-3-5-18-20(17)16(12-22-18)10-19(21)23/h3-5,11-12,19,22H,6-10,13-14H2,1-2H3/t19-,21+/m1/s1 |
| InChIKey | QPUKMGQUKHWNOZ-CTNGQTDRSA-N |
| XLogP | 2.14 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|