C17H22N2O2 — CID 139024106
[(6aR,9R,10aS)-7-methyl-10a-(trideuteriomethoxy)-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol (PubChem CID 139024106) has the molecular formula C17H22N2O2 and a molecular weight of 289.39 g/mol. Its IUPAC name is [(6aR,9R,10aS)-7-methyl-10a-(trideuteriomethoxy)-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol.
| Compound Name | [(6aR,9R,10aS)-7-methyl-10a-(trideuteriomethoxy)-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol |
|---|---|
| PubChem CID | 139024106 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | [(6aR,9R,10aS)-7-methyl-10a-(trideuteriomethoxy)-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol |
| SMILES | [2H]C([2H])([2H])O[C@]12C[C@@H](CO)CN(C)[C@@H]1Cc1c[nH]c3cccc2c13 |
| InChI | InChI=1S/C17H22N2O2/c1-19-9-11(10-20)7-17(21-2)13-4-3-5-14-16(13)12(8-18-14)6-15(17)19/h3-5,8,11,15,18,20H,6-7,9-10H2,1-2H3/t11-,15-,17+/m1/s1/i2D3 |
| InChIKey | JGQZSBLQHCTAJF-RQWSDIPHSA-N |
| XLogP | 1.88 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |