C21H28N2O4 — CID 129236224
4-(ethenylamino)butyl 6-(2,2-dimethylpropanoyloxy)-4-methyl-1H-indole-3-carboxylate (PubChem CID 129236224) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-(ethenylamino)butyl 6-(2,2-dimethylpropanoyloxy)-4-methyl-1H-indole-3-carboxylate.
| Compound Name | 4-(ethenylamino)butyl 6-(2,2-dimethylpropanoyloxy)-4-methyl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 129236224 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-(ethenylamino)butyl 6-(2,2-dimethylpropanoyloxy)-4-methyl-1H-indole-3-carboxylate |
| SMILES | C=CNCCCCOC(=O)c1c[nH]c2cc(OC(=O)C(C)(C)C)cc(C)c12 |
| InChI | InChI=1S/C21H28N2O4/c1-6-22-9-7-8-10-26-19(24)16-13-23-17-12-15(11-14(2)18(16)17)27-20(25)21(3,4)5/h6,11-13,22-23H,1,7-10H2,2-5H3 |
| InChIKey | YFOJJDYGSQZTJC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|