C23H39NO3 — CID 129238436
tert-butyl (3E,6Z)-3-ethenyl-4-[ethyl(3-methoxypentan-2-yl)amino]nona-3,6,8-trienoate (PubChem CID 129238436) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is tert-butyl (3E,6Z)-3-ethenyl-4-[ethyl(3-methoxypentan-2-yl)amino]nona-3,6,8-trienoate.
| Compound Name | tert-butyl (3E,6Z)-3-ethenyl-4-[ethyl(3-methoxypentan-2-yl)amino]nona-3,6,8-trienoate |
|---|---|
| PubChem CID | 129238436 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | tert-butyl (3E,6Z)-3-ethenyl-4-[ethyl(3-methoxypentan-2-yl)amino]nona-3,6,8-trienoate |
| SMILES | C=C/C=C\C/C(=C(\C=C)CC(=O)OC(C)(C)C)N(CC)C(C)C(CC)OC |
| InChI | InChI=1S/C23H39NO3/c1-10-14-15-16-20(24(13-4)18(5)21(12-3)26-9)19(11-2)17-22(25)27-23(6,7)8/h10-11,14-15,18,21H,1-2,12-13,16-17H2,3-9H3/b15-14-,20-19- |
| InChIKey | QSWGQHSOUFUTRK-DYRMKCCWSA-N |
| XLogP | 5.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|