C18H22Cl2F3N2O8P — CID 129263727
1-[(2R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-5-[5-methyl-2-(2,2,2-trifluoroacetyl)hex-4-enyl]pyrimidine-2,4-dione (PubChem CID 129263727) has the molecular formula C18H22Cl2F3N2O8P and a molecular weight of 553.25 g/mol. Its IUPAC name is 1-[(2R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-5-[5-methyl-2-(2,2,2-trifluoroacetyl)hex-4-enyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-5-[5-methyl-2-(2,2,2-trifluoroacetyl)hex-4-enyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129263727 |
| Molecular Formula | C18H22Cl2F3N2O8P |
| Molecular Weight | 553.25 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | 1-[(2R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-5-[5-methyl-2-(2,2,2-trifluoroacetyl)hex-4-enyl]pyrimidine-2,4-dione |
| SMILES | CC(C)=CCC(Cc1cn([C@@H]2O[C@H](COP(=O)(Cl)Cl)C(O)C2O)c(=O)[nH]c1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H22Cl2F3N2O8P/c1-8(2)3-4-9(14(28)18(21,22)23)5-10-6-25(17(30)24-15(10)29)16-13(27)12(26)11(33-16)7-32-34(19,20)31/h3,6,9,11-13,16,26-27H,4-5,7H2,1-2H3,(H,24,29,30)/t9?,11-,12?,13?,16-/m1/s1 |
| InChIKey | HXDBHVAFHACZRA-OINLZDNRSA-N |
| XLogP | 2.40 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|