C17H21Cl2F3N3O8P — CID 154473286
N-[[1-[(2R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoro-N-(3-methylbut-2-enyl)acetamide (PubChem CID 154473286) has the molecular formula C17H21Cl2F3N3O8P and a molecular weight of 554.24 g/mol. Its IUPAC name is N-[[1-[(2R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoro-N-(3-methylbut-2-enyl)acetamide.
| Compound Name | N-[[1-[(2R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoro-N-(3-methylbut-2-enyl)acetamide |
|---|---|
| PubChem CID | 154473286 |
| Molecular Formula | C17H21Cl2F3N3O8P |
| Molecular Weight | 554.24 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | N-[[1-[(2R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoro-N-(3-methylbut-2-enyl)acetamide |
| SMILES | CC(C)=CCN(Cc1cn([C@@H]2O[C@H](COP(=O)(Cl)Cl)C(O)C2O)c(=O)[nH]c1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C17H21Cl2F3N3O8P/c1-8(2)3-4-24(15(29)17(20,21)22)5-9-6-25(16(30)23-13(9)28)14-12(27)11(26)10(33-14)7-32-34(18,19)31/h3,6,10-12,14,26-27H,4-5,7H2,1-2H3,(H,23,28,30)/t10-,11?,12?,14-/m1/s1 |
| InChIKey | FOWSBJDHMGJTHV-MLCFOIATSA-N |
| XLogP | 1.62 |
| TPSA | 151.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|