C21H35N2O8P — CID 129270268
[ethoxy-[[2-(phenylmethoxycarbonylamino)ethyl-propylamino]methyl]phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 129270268) has the molecular formula C21H35N2O8P and a molecular weight of 474.49 g/mol. Its IUPAC name is [ethoxy-[[2-(phenylmethoxycarbonylamino)ethyl-propylamino]methyl]phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [ethoxy-[[2-(phenylmethoxycarbonylamino)ethyl-propylamino]methyl]phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 129270268 |
| Molecular Formula | C21H35N2O8P |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | [ethoxy-[[2-(phenylmethoxycarbonylamino)ethyl-propylamino]methyl]phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | CCCN(CCNC(=O)OCc1ccccc1)CP(=O)(OCC)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C21H35N2O8P/c1-5-13-23(14-12-22-20(24)27-15-19-10-8-7-9-11-19)16-32(26,29-6-2)30-17-28-21(25)31-18(3)4/h7-11,18H,5-6,12-17H2,1-4H3,(H,22,24) |
| InChIKey | HAERNOYYUAFGCE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|