C10H9F10N — CID 129271430
1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine (PubChem CID 129271430) has the molecular formula C10H9F10N and a molecular weight of 333.17 g/mol. Its IUPAC name is 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine.
| Compound Name | 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 129271430 |
| Molecular Formula | C10H9F10N |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine |
| SMILES | FC(F)=C(F)C(F)(N1CCC(C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H9F10N/c11-6(7(12)13)8(14,10(18,19)20)21-3-1-5(2-4-21)9(15,16)17/h5H,1-4H2 |
| InChIKey | QSJHAKREPBCDRD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|