C31H35F3N6O2S — CID 129294747
1-[hydroxy-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butylamino]methyl]-3-(5-methyl-2-propylphenyl)thiourea (PubChem CID 129294747) has the molecular formula C31H35F3N6O2S and a molecular weight of 612.72 g/mol. Its IUPAC name is 1-[hydroxy-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butylamino]methyl]-3-(5-methyl-2-propylphenyl)thiourea.
| Compound Name | 1-[hydroxy-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butylamino]methyl]-3-(5-methyl-2-propylphenyl)thiourea |
|---|---|
| PubChem CID | 129294747 |
| Molecular Formula | C31H35F3N6O2S |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 1-[hydroxy-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butylamino]methyl]-3-(5-methyl-2-propylphenyl)thiourea |
| SMILES | CCCc1ccc(C)cc1NC(=S)NC(O)NCCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C31H35F3N6O2S/c1-3-6-23-11-8-21(2)19-27(23)37-30(43)38-29(41)35-18-5-4-7-22-9-12-24(13-10-22)28-36-20-40(39-28)25-14-16-26(17-15-25)42-31(32,33)34/h8-17,19-20,29,35,41H,3-7,18H2,1-2H3,(H2,37,38,43) |
| InChIKey | FJYAOPRVWJVNAO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|