C15H22O2 — CID 129304454
2-methylpropyl (2E)-2-[(1R,3R,5R)-3-ethenyl-6-bicyclo[3.2.0]heptanylidene]acetate (PubChem CID 129304454) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-methylpropyl (2E)-2-[(1R,3R,5R)-3-ethenyl-6-bicyclo[3.2.0]heptanylidene]acetate.
| Compound Name | 2-methylpropyl (2E)-2-[(1R,3R,5R)-3-ethenyl-6-bicyclo[3.2.0]heptanylidene]acetate |
|---|---|
| PubChem CID | 129304454 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-methylpropyl (2E)-2-[(1R,3R,5R)-3-ethenyl-6-bicyclo[3.2.0]heptanylidene]acetate |
| SMILES | C=C[C@@H]1C[C@@H]2C/C(=C\C(=O)OCC(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C15H22O2/c1-4-11-5-12-7-13(14(12)6-11)8-15(16)17-9-10(2)3/h4,8,10-12,14H,1,5-7,9H2,2-3H3/b13-8+/t11-,12-,14-/m1/s1 |
| InChIKey | HQDHYFGKDKKMIS-WYUOYJLWSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|