C16H21NO2 — CID 129312276
(3E,4Z)-3-ethylidene-2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylhepta-4,6-dienamide (PubChem CID 129312276) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylhepta-4,6-dienamide.
| Compound Name | (3E,4Z)-3-ethylidene-2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 129312276 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (3E,4Z)-3-ethylidene-2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylhepta-4,6-dienamide |
| SMILES | C=C/C=C\C(=C/C)C(O/C(C=C)=C/C=C)C(=O)NC |
| InChI | InChI=1S/C16H21NO2/c1-6-10-12-13(8-3)15(16(18)17-5)19-14(9-4)11-7-2/h6-12,15H,1-2,4H2,3,5H3,(H,17,18)/b12-10-,13-8+,14-11+ |
| InChIKey | DKGHLCSNJXXBDW-DOEOMNFISA-N |
| XLogP | 3.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|