C18H26FNO3 — CID 134333490
2-[(1E,3E)-2-ethyl-4-fluorohexa-1,3,5-trienoxy]-N-[(3Z,5E)-5-methoxyhepta-3,5-dienyl]acetamide (PubChem CID 134333490) has the molecular formula C18H26FNO3 and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-[(1E,3E)-2-ethyl-4-fluorohexa-1,3,5-trienoxy]-N-[(3Z,5E)-5-methoxyhepta-3,5-dienyl]acetamide.
| Compound Name | 2-[(1E,3E)-2-ethyl-4-fluorohexa-1,3,5-trienoxy]-N-[(3Z,5E)-5-methoxyhepta-3,5-dienyl]acetamide |
|---|---|
| PubChem CID | 134333490 |
| Molecular Formula | C18H26FNO3 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-[(1E,3E)-2-ethyl-4-fluorohexa-1,3,5-trienoxy]-N-[(3Z,5E)-5-methoxyhepta-3,5-dienyl]acetamide |
| SMILES | C=C/C(F)=C\C(=C\OCC(=O)NCC/C=C\C(=C/C)OC)CC |
| InChI | InChI=1S/C18H26FNO3/c1-5-15(12-16(19)6-2)13-23-14-18(21)20-11-9-8-10-17(7-3)22-4/h6-8,10,12-13H,2,5,9,11,14H2,1,3-4H3,(H,20,21)/b10-8-,15-13+,16-12+,17-7+ |
| InChIKey | ACCNMRZVQGHORV-WQPZNZBVSA-N |
| XLogP | 3.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|