C9H7BrN2O3S — CID 129314070
(3-bromo-6-methoxythieno[3,2-b]pyridin-2-yl) carbamate (PubChem CID 129314070) has the molecular formula C9H7BrN2O3S and a molecular weight of 303.14 g/mol. Its IUPAC name is (3-bromo-6-methoxythieno[3,2-b]pyridin-2-yl) carbamate.
| Compound Name | (3-bromo-6-methoxythieno[3,2-b]pyridin-2-yl) carbamate |
|---|---|
| PubChem CID | 129314070 |
| Molecular Formula | C9H7BrN2O3S |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | (3-bromo-6-methoxythieno[3,2-b]pyridin-2-yl) carbamate |
| SMILES | COc1cnc2c(Br)c(OC(N)=O)sc2c1 |
| InChI | InChI=1S/C9H7BrN2O3S/c1-14-4-2-5-7(12-3-4)6(10)8(16-5)15-9(11)13/h2-3H,1H3,(H2,11,13) |
| InChIKey | PUNSYICZBSKSPI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |