C8H15NO2S — CID 129321928
(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-benzo[d]thiazine 2,2-dioxide (PubChem CID 129321928) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is (4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-benzo[d]thiazine 2,2-dioxide.
| Compound Name | (4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-benzo[d]thiazine 2,2-dioxide |
|---|---|
| PubChem CID | 129321928 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-benzo[d]thiazine 2,2-dioxide |
| SMILES | O=S1(=O)C[C@H]2CCCC[C@@H]2CN1 |
| InChI | InChI=1S/C8H15NO2S/c10-12(11)6-8-4-2-1-3-7(8)5-9-12/h7-9H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | KASCEXGVDUUFJA-HTQZYQBOSA-N |
| XLogP | 0.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |