C11H12FNO3 — CID 129348699
(3R)-N-(3-fluorophenyl)-3-hydroxyoxolane-3-carboxamide (PubChem CID 129348699) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is (3R)-N-(3-fluorophenyl)-3-hydroxyoxolane-3-carboxamide.
| Compound Name | (3R)-N-(3-fluorophenyl)-3-hydroxyoxolane-3-carboxamide |
|---|---|
| PubChem CID | 129348699 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (3R)-N-(3-fluorophenyl)-3-hydroxyoxolane-3-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)[C@@]1(O)CCOC1 |
| InChI | InChI=1S/C11H12FNO3/c12-8-2-1-3-9(6-8)13-10(14)11(15)4-5-16-7-11/h1-3,6,15H,4-5,7H2,(H,13,14)/t11-/m1/s1 |
| InChIKey | UIFOJCCOYPGHES-LLVKDONJSA-N |
| XLogP | 0.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |