C17H30N2O3 — CID 129422421
(1R,2S,4R)-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 129422421) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is (1R,2S,4R)-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,4R)-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 129422421 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (1R,2S,4R)-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | C[C@@H]1CN(CCCCNC(=O)[C@H]2C[C@H]3CC[C@H]2O3)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H30N2O3/c1-12-10-19(11-13(2)21-12)8-4-3-7-18-17(20)15-9-14-5-6-16(15)22-14/h12-16H,3-11H2,1-2H3,(H,18,20)/t12-,13-,14-,15+,16-/m1/s1 |
| InChIKey | KNZGEPYVGSFWQC-DGXTUMSLSA-N |
| XLogP | 1.56 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|