C14H23F3N2O2S — CID 129432123
(1S,2S,3R)-2,3-dimethyl-1-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1,4-thiazinane-4-carboxamide (PubChem CID 129432123) has the molecular formula C14H23F3N2O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is (1S,2S,3R)-2,3-dimethyl-1-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1,4-thiazinane-4-carboxamide.
| Compound Name | (1S,2S,3R)-2,3-dimethyl-1-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 129432123 |
| Molecular Formula | C14H23F3N2O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (1S,2S,3R)-2,3-dimethyl-1-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1,4-thiazinane-4-carboxamide |
| SMILES | C[C@@H]1[C@H](C)[S@@](=O)CCN1C(=O)N[C@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C14H23F3N2O2S/c1-9-10(2)22(21)7-6-19(9)13(20)18-12-5-3-4-11(8-12)14(15,16)17/h9-12H,3-8H2,1-2H3,(H,18,20)/t9-,10+,11+,12+,22+/m1/s1 |
| InChIKey | CIIJCJIUSRRBJL-WMDYREEDSA-N |
| XLogP | 2.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |