C10H17NOS — CID 12944070
2-heptyl-1,2-thiazol-3-one (PubChem CID 12944070) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is 2-heptyl-1,2-thiazol-3-one.
| Compound Name | 2-heptyl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 12944070 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-heptyl-1,2-thiazol-3-one |
| SMILES | CCCCCCCn1sccc1=O |
| InChI | InChI=1S/C10H17NOS/c1-2-3-4-5-6-8-11-10(12)7-9-13-11/h7,9H,2-6,8H2,1H3 |
| InChIKey | XAJLJECTABLVRG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|